C12H16NO2- — CID 57352336
N-(2,6-dimethylphenyl)-N-propan-2-ylcarbamate (PubChem CID 57352336) has the molecular formula C12H16NO2- and a molecular weight of 206.27 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-N-propan-2-ylcarbamate.
| Compound Name | N-(2,6-dimethylphenyl)-N-propan-2-ylcarbamate |
|---|---|
| PubChem CID | 57352336 |
| Molecular Formula | C12H16NO2- |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | N-(2,6-dimethylphenyl)-N-propan-2-ylcarbamate |
| SMILES | Cc1cccc(C)c1N(C(=O)[O-])C(C)C |
| InChI | InChI=1S/C12H17NO2/c1-8(2)13(12(14)15)11-9(3)6-5-7-10(11)4/h5-8H,1-4H3,(H,14,15)/p-1 |
| InChIKey | OAWWJVGZCUDOOA-UHFFFAOYSA-M |
| XLogP | 1.86 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |