C12H8N2 — CID 57352364
1,8-diazatetracyclo[7.5.0.02,7.011,14]tetradeca-2,4,6,8,10,13-hexaene (PubChem CID 57352364) has the molecular formula C12H8N2 and a molecular weight of 180.21 g/mol. Its IUPAC name is 1,8-diazatetracyclo[7.5.0.02,7.011,14]tetradeca-2,4,6,8,10,13-hexaene.
| Compound Name | 1,8-diazatetracyclo[7.5.0.02,7.011,14]tetradeca-2,4,6,8,10,13-hexaene |
|---|---|
| PubChem CID | 57352364 |
| Molecular Formula | C12H8N2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.07 |
| IUPAC Name | 1,8-diazatetracyclo[7.5.0.02,7.011,14]tetradeca-2,4,6,8,10,13-hexaene |
| SMILES | C1=c2c(cc3nc4ccccc4n23)C1 |
| InChI | InChI=1S/C12H8N2/c1-2-4-11-9(3-1)13-12-7-8-5-6-10(8)14(11)12/h1-4,6-7H,5H2 |
| InChIKey | VFDLRSKUCVWEKV-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |