C10H12NO4S- — CID 57353313
2-[(4-aminophenyl)methylsulfonyl]propanoate (PubChem CID 57353313) has the molecular formula C10H12NO4S- and a molecular weight of 242.28 g/mol. Its IUPAC name is 2-[(4-aminophenyl)methylsulfonyl]propanoate.
| Compound Name | 2-[(4-aminophenyl)methylsulfonyl]propanoate |
|---|---|
| PubChem CID | 57353313 |
| Molecular Formula | C10H12NO4S- |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | 2-[(4-aminophenyl)methylsulfonyl]propanoate |
| SMILES | CC(C(=O)[O-])S(=O)(=O)Cc1ccc(N)cc1 |
| InChI | InChI=1S/C10H13NO4S/c1-7(10(12)13)16(14,15)6-8-2-4-9(11)5-3-8/h2-5,7H,6,11H2,1H3,(H,12,13)/p-1 |
| InChIKey | GMJZECKJBDFNPO-UHFFFAOYSA-M |
| XLogP | -0.68 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|