C32H35NO5 — CID 57356846
1-[2-[4-(5,14-dimethoxy-8,18-dioxatetracyclo[9.8.0.02,7.012,17]nonadeca-1(11),2(7),3,5,12(17),13,15-heptaen-9-yl)phenoxy]ethyl]piperidine (PubChem CID 57356846) has the molecular formula C32H35NO5 and a molecular weight of 513.63 g/mol. Its IUPAC name is 1-[2-[4-(5,14-dimethoxy-8,18-dioxatetracyclo[9.8.0.02,7.012,17]nonadeca-1(11),2(7),3,5,12(17),13,15-heptaen-9-yl)phenoxy]ethyl]piperidine.
| Compound Name | 1-[2-[4-(5,14-dimethoxy-8,18-dioxatetracyclo[9.8.0.02,7.012,17]nonadeca-1(11),2(7),3,5,12(17),13,15-heptaen-9-yl)phenoxy]ethyl]piperidine |
|---|---|
| PubChem CID | 57356846 |
| Molecular Formula | C32H35NO5 |
| Molecular Weight | 513.63 g/mol |
| Exact Mass | 513.25 |
| IUPAC Name | 1-[2-[4-(5,14-dimethoxy-8,18-dioxatetracyclo[9.8.0.02,7.012,17]nonadeca-1(11),2(7),3,5,12(17),13,15-heptaen-9-yl)phenoxy]ethyl]piperidine |
| SMILES | COc1ccc2c(c1)OC(c1ccc(OCCN3CCCCC3)cc1)CC1=C2COc2ccc(OC)cc21 |
| InChI | InChI=1S/C32H35NO5/c1-34-24-11-13-30-28(18-24)27-20-31(38-32-19-25(35-2)10-12-26(32)29(27)21-37-30)22-6-8-23(9-7-22)36-17-16-33-14-4-3-5-15-33/h6-13,18-19,31H,3-5,14-17,20-21H2,1-2H3 |
| InChIKey | FUIWZNGTKJQCBR-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.63 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|