C16H14F2N3O4S- — CID 57356924
5-(difluoromethoxy)-2-[(3,4-dimethoxy-2-pyridinyl)methylsulfanyl]-1-oxidobenzimidazole (PubChem CID 57356924) has the molecular formula C16H14F2N3O4S- and a molecular weight of 382.37 g/mol. Its IUPAC name is 5-(difluoromethoxy)-2-[(3,4-dimethoxy-2-pyridinyl)methylsulfanyl]-1-oxidobenzimidazole.
| Compound Name | 5-(difluoromethoxy)-2-[(3,4-dimethoxy-2-pyridinyl)methylsulfanyl]-1-oxidobenzimidazole |
|---|---|
| PubChem CID | 57356924 |
| Molecular Formula | C16H14F2N3O4S- |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | 5-(difluoromethoxy)-2-[(3,4-dimethoxy-2-pyridinyl)methylsulfanyl]-1-oxidobenzimidazole |
| SMILES | COc1ccnc(CSc2nc3cc(OC(F)F)ccc3n2[O-])c1OC |
| InChI | InChI=1S/C16H14F2N3O4S/c1-23-13-5-6-19-11(14(13)24-2)8-26-16-20-10-7-9(25-15(17)18)3-4-12(10)21(16)22/h3-7,15H,8H2,1-2H3/q-1 |
| InChIKey | KHIZUYKKUSGFPX-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 81.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|