C17H14F2N4O5S — CID 153176364
[5-(difluoromethoxy)-2-[(3,4-dimethoxy-2-pyridinyl)methylsulfinyl]benzimidazol-1-yl] cyanate (PubChem CID 153176364) has the molecular formula C17H14F2N4O5S and a molecular weight of 424.39 g/mol. Its IUPAC name is [5-(difluoromethoxy)-2-[(3,4-dimethoxy-2-pyridinyl)methylsulfinyl]benzimidazol-1-yl] cyanate.
| Compound Name | [5-(difluoromethoxy)-2-[(3,4-dimethoxy-2-pyridinyl)methylsulfinyl]benzimidazol-1-yl] cyanate |
|---|---|
| PubChem CID | 153176364 |
| Molecular Formula | C17H14F2N4O5S |
| Molecular Weight | 424.39 g/mol |
| Exact Mass | 424.07 |
| IUPAC Name | [5-(difluoromethoxy)-2-[(3,4-dimethoxy-2-pyridinyl)methylsulfinyl]benzimidazol-1-yl] cyanate |
| SMILES | COc1ccnc(CS(=O)c2nc3cc(OC(F)F)ccc3n2OC#N)c1OC |
| InChI | InChI=1S/C17H14F2N4O5S/c1-25-14-5-6-21-12(15(14)26-2)8-29(24)17-22-11-7-10(28-16(18)19)3-4-13(11)23(17)27-9-20/h3-7,16H,8H2,1-2H3 |
| InChIKey | WFGMAJSMLYKYLB-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 108.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.39 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|