2-ethyl-6-oxo-4,5-dihydro-3H-pyridine-4-carboxylic acid

C8H11NO3 — CID 57357094

IUPAC2-ethyl-6-oxo-4,5-dihydro-3H-pyridine-4-carboxylic acid
SMILESCCC1=NC(=O)CC(C(=O)O)C1
InChIInChI=1S/C8H11NO3/c1-2-6-3-5(8(11)12)4-7(10)9-6/h5H,2-4H2,1H3,(H,11,12)
InChIKeyRXPUZTIYHQTNEM-UHFFFAOYSA-N
MW169.18 g/mol
LogP0.86
Rot. Bonds2

About 2-ethyl-6-oxo-4,5-dihydro-3H-pyridine-4-carboxylic acid

2-ethyl-6-oxo-4,5-dihydro-3H-pyridine-4-carboxylic acid (PubChem CID 57357094) has the molecular formula C8H11NO3 and a molecular weight of 169.18 g/mol. Its IUPAC name is 2-ethyl-6-oxo-4,5-dihydro-3H-pyridine-4-carboxylic acid.

Molecular Properties

Compound Name2-ethyl-6-oxo-4,5-dihydro-3H-pyridine-4-carboxylic acid
PubChem CID57357094
Molecular FormulaC8H11NO3
Molecular Weight169.18 g/mol
Exact Mass169.07
IUPAC Name2-ethyl-6-oxo-4,5-dihydro-3H-pyridine-4-carboxylic acid
SMILESCCC1=NC(=O)CC(C(=O)O)C1
InChIInChI=1S/C8H11NO3/c1-2-6-3-5(8(11)12)4-7(10)9-6/h5H,2-4H2,1H3,(H,11,12)
InChIKeyRXPUZTIYHQTNEM-UHFFFAOYSA-N
XLogP0.86
TPSA66.73 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500169.18
LogP ≤ 50.86
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-ethyl-6-oxo-4,5-dihydro-3H-pyridine-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-ethyl-6-oxo-4,5-dihydro-3H-pyridine-4-carboxylic acid?
The IUPAC name of 2-ethyl-6-oxo-4,5-dihydro-3H-pyridine-4-carboxylic acid (CID 57357094) is 2-ethyl-6-oxo-4,5-dihydro-3H-pyridine-4-carboxylic acid.
What is the SMILES notation for 2-ethyl-6-oxo-4,5-dihydro-3H-pyridine-4-carboxylic acid?
The canonical SMILES for 2-ethyl-6-oxo-4,5-dihydro-3H-pyridine-4-carboxylic acid is CCC1=NC(=O)CC(C(=O)O)C1.
What is the InChIKey of 2-ethyl-6-oxo-4,5-dihydro-3H-pyridine-4-carboxylic acid?
The InChIKey is RXPUZTIYHQTNEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO3/c1-2-6-3-5(8(11)12)4-7(10)9-6/h5H,2-4H2,1H3,(H,11,12).
What are the key properties of 2-ethyl-6-oxo-4,5-dihydro-3H-pyridine-4-carboxylic acid?
2-ethyl-6-oxo-4,5-dihydro-3H-pyridine-4-carboxylic acid has a molecular weight of 169.18 g/mol, XLogP of 0.86, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-6-oxo-4,5-dihydro-3H-pyridine-4-carboxylic acid is sourced from PubChem (CID 57357094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).