C17H18N2O8 — CID 57360821
ethyl (2S)-2-[2-(3-acetyl-7-hydroxy-2-oxochromene-5-carbonyl)hydrazinyl]-3-hydroxypropanoate (PubChem CID 57360821) has the molecular formula C17H18N2O8 and a molecular weight of 378.34 g/mol. Its IUPAC name is ethyl (2S)-2-[2-(3-acetyl-7-hydroxy-2-oxochromene-5-carbonyl)hydrazinyl]-3-hydroxypropanoate.
| Compound Name | ethyl (2S)-2-[2-(3-acetyl-7-hydroxy-2-oxochromene-5-carbonyl)hydrazinyl]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 57360821 |
| Molecular Formula | C17H18N2O8 |
| Molecular Weight | 378.34 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | ethyl (2S)-2-[2-(3-acetyl-7-hydroxy-2-oxochromene-5-carbonyl)hydrazinyl]-3-hydroxypropanoate |
| SMILES | CCOC(=O)[C@H](CO)NNC(=O)c1cc(O)cc2oc(=O)c(C(C)=O)cc12 |
| InChI | InChI=1S/C17H18N2O8/c1-3-26-17(25)13(7-20)18-19-15(23)12-4-9(22)5-14-11(12)6-10(8(2)21)16(24)27-14/h4-6,13,18,20,22H,3,7H2,1-2H3,(H,19,23)/t13-/m0/s1 |
| InChIKey | RKJONCQYPDADRL-ZDUSSCGKSA-N |
| XLogP | -0.14 |
| TPSA | 155.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.34 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|