C16H16N2O7 — CID 57361032
ethyl 2-[2-(3-acetyl-7-hydroxy-2-oxochromene-5-carbonyl)hydrazinyl]acetate (PubChem CID 57361032) has the molecular formula C16H16N2O7 and a molecular weight of 348.31 g/mol. Its IUPAC name is ethyl 2-[2-(3-acetyl-7-hydroxy-2-oxochromene-5-carbonyl)hydrazinyl]acetate.
| Compound Name | ethyl 2-[2-(3-acetyl-7-hydroxy-2-oxochromene-5-carbonyl)hydrazinyl]acetate |
|---|---|
| PubChem CID | 57361032 |
| Molecular Formula | C16H16N2O7 |
| Molecular Weight | 348.31 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | ethyl 2-[2-(3-acetyl-7-hydroxy-2-oxochromene-5-carbonyl)hydrazinyl]acetate |
| SMILES | CCOC(=O)CNNC(=O)c1cc(O)cc2oc(=O)c(C(C)=O)cc12 |
| InChI | InChI=1S/C16H16N2O7/c1-3-24-14(21)7-17-18-15(22)12-4-9(20)5-13-11(12)6-10(8(2)19)16(23)25-13/h4-6,17,20H,3,7H2,1-2H3,(H,18,22) |
| InChIKey | IUVIEUIIBXSUHG-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 134.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.31 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|