C15H11ClN2O4 — CID 57361745
(4-chlorobenzoyl)carbamoyl-phenylcarbamic acid (PubChem CID 57361745) has the molecular formula C15H11ClN2O4 and a molecular weight of 318.72 g/mol. Its IUPAC name is (4-chlorobenzoyl)carbamoyl-phenylcarbamic acid.
| Compound Name | (4-chlorobenzoyl)carbamoyl-phenylcarbamic acid |
|---|---|
| PubChem CID | 57361745 |
| Molecular Formula | C15H11ClN2O4 |
| Molecular Weight | 318.72 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | (4-chlorobenzoyl)carbamoyl-phenylcarbamic acid |
| SMILES | O=C(NC(=O)N(C(=O)O)c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H11ClN2O4/c16-11-8-6-10(7-9-11)13(19)17-14(20)18(15(21)22)12-4-2-1-3-5-12/h1-9H,(H,21,22)(H,17,19,20) |
| InChIKey | CDFRIKPNOFHALZ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.72 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |