C14H17N3O4S — CID 57362515
methyl (2S)-2-amino-3-[3-(4-methylphenyl)sulfonylimidazol-4-yl]propanoate (PubChem CID 57362515) has the molecular formula C14H17N3O4S and a molecular weight of 323.37 g/mol. Its IUPAC name is methyl (2S)-2-amino-3-[3-(4-methylphenyl)sulfonylimidazol-4-yl]propanoate.
| Compound Name | methyl (2S)-2-amino-3-[3-(4-methylphenyl)sulfonylimidazol-4-yl]propanoate |
|---|---|
| PubChem CID | 57362515 |
| Molecular Formula | C14H17N3O4S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | methyl (2S)-2-amino-3-[3-(4-methylphenyl)sulfonylimidazol-4-yl]propanoate |
| SMILES | COC(=O)[C@@H](N)Cc1cncn1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H17N3O4S/c1-10-3-5-12(6-4-10)22(19,20)17-9-16-8-11(17)7-13(15)14(18)21-2/h3-6,8-9,13H,7,15H2,1-2H3/t13-/m0/s1 |
| InChIKey | YHYBSKCDRPADLR-ZDUSSCGKSA-N |
| XLogP | 0.47 |
| TPSA | 104.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |