C25H40O2S — CID 57362852
(1S,2S,11R,12S,16S)-15-(1-methoxycyclopentyl)oxy-2,16-dimethyl-5-thiapentacyclo[9.7.0.02,8.04,6.012,16]octadecane (PubChem CID 57362852) has the molecular formula C25H40O2S and a molecular weight of 404.66 g/mol. Its IUPAC name is (1S,2S,11R,12S,16S)-15-(1-methoxycyclopentyl)oxy-2,16-dimethyl-5-thiapentacyclo[9.7.0.02,8.04,6.012,16]octadecane.
| Compound Name | (1S,2S,11R,12S,16S)-15-(1-methoxycyclopentyl)oxy-2,16-dimethyl-5-thiapentacyclo[9.7.0.02,8.04,6.012,16]octadecane |
|---|---|
| PubChem CID | 57362852 |
| Molecular Formula | C25H40O2S |
| Molecular Weight | 404.66 g/mol |
| Exact Mass | 404.27 |
| IUPAC Name | (1S,2S,11R,12S,16S)-15-(1-methoxycyclopentyl)oxy-2,16-dimethyl-5-thiapentacyclo[9.7.0.02,8.04,6.012,16]octadecane |
| SMILES | COC1(OC2CC[C@H]3[C@@H]4CCC5CC6SC6C[C@]5(C)[C@H]4CC[C@]23C)CCCC1 |
| InChI | InChI=1S/C25H40O2S/c1-23-13-10-19-17(7-6-16-14-20-21(28-20)15-24(16,19)2)18(23)8-9-22(23)27-25(26-3)11-4-5-12-25/h16-22H,4-15H2,1-3H3/t16?,17-,18-,19-,20?,21?,22?,23-,24-/m0/s1 |
| InChIKey | IVDYZAAPOLNZKG-KTASMACZSA-N |
| XLogP | 6.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.66 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|