C19H16NO6- — CID 57363248
N-(2,4-dimethoxyphenyl)-N-(4-methyl-2-oxochromen-7-yl)carbamate (PubChem CID 57363248) has the molecular formula C19H16NO6- and a molecular weight of 354.34 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-N-(4-methyl-2-oxochromen-7-yl)carbamate.
| Compound Name | N-(2,4-dimethoxyphenyl)-N-(4-methyl-2-oxochromen-7-yl)carbamate |
|---|---|
| PubChem CID | 57363248 |
| Molecular Formula | C19H16NO6- |
| Molecular Weight | 354.34 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-N-(4-methyl-2-oxochromen-7-yl)carbamate |
| SMILES | COc1ccc(N(C(=O)[O-])c2ccc3c(C)cc(=O)oc3c2)c(OC)c1 |
| InChI | InChI=1S/C19H17NO6/c1-11-8-18(21)26-16-9-12(4-6-14(11)16)20(19(22)23)15-7-5-13(24-2)10-17(15)25-3/h4-10H,1-3H3,(H,22,23)/p-1 |
| InChIKey | RDMYCKUQMFONIY-UHFFFAOYSA-M |
| XLogP | 2.60 |
| TPSA | 92.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.34 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|