C25H34N2O7S2 — CID 57363503
[2-hydroxy-3-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]-1-phenylsulfanylpropyl]-[(3S)-oxolan-3-yl]carbamic acid (PubChem CID 57363503) has the molecular formula C25H34N2O7S2 and a molecular weight of 538.69 g/mol. Its IUPAC name is [2-hydroxy-3-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]-1-phenylsulfanylpropyl]-[(3S)-oxolan-3-yl]carbamic acid.
| Compound Name | [2-hydroxy-3-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]-1-phenylsulfanylpropyl]-[(3S)-oxolan-3-yl]carbamic acid |
|---|---|
| PubChem CID | 57363503 |
| Molecular Formula | C25H34N2O7S2 |
| Molecular Weight | 538.69 g/mol |
| Exact Mass | 538.18 |
| IUPAC Name | [2-hydroxy-3-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]-1-phenylsulfanylpropyl]-[(3S)-oxolan-3-yl]carbamic acid |
| SMILES | COc1ccc(S(=O)(=O)N(CC(C)C)CC(O)C(Sc2ccccc2)N(C(=O)O)[C@H]2CCOC2)cc1 |
| InChI | InChI=1S/C25H34N2O7S2/c1-18(2)15-26(36(31,32)22-11-9-20(33-3)10-12-22)16-23(28)24(35-21-7-5-4-6-8-21)27(25(29)30)19-13-14-34-17-19/h4-12,18-19,23-24,28H,13-17H2,1-3H3,(H,29,30)/t19-,23?,24?/m0/s1 |
| InChIKey | PPZHBDRSEWKVII-HLJPNSHOSA-N |
| XLogP | 3.59 |
| TPSA | 116.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.69 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|