C28H33N2O6S2- — CID 57363504
N-benzyl-N-[2-hydroxy-3-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]-1-phenylsulfanylpropyl]carbamate (PubChem CID 57363504) has the molecular formula C28H33N2O6S2- and a molecular weight of 557.71 g/mol. Its IUPAC name is N-benzyl-N-[2-hydroxy-3-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]-1-phenylsulfanylpropyl]carbamate.
| Compound Name | N-benzyl-N-[2-hydroxy-3-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]-1-phenylsulfanylpropyl]carbamate |
|---|---|
| PubChem CID | 57363504 |
| Molecular Formula | C28H33N2O6S2- |
| Molecular Weight | 557.71 g/mol |
| Exact Mass | 557.18 |
| IUPAC Name | N-benzyl-N-[2-hydroxy-3-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]-1-phenylsulfanylpropyl]carbamate |
| SMILES | COc1ccc(S(=O)(=O)N(CC(C)C)CC(O)C(Sc2ccccc2)N(Cc2ccccc2)C(=O)[O-])cc1 |
| InChI | InChI=1S/C28H34N2O6S2/c1-21(2)18-29(38(34,35)25-16-14-23(36-3)15-17-25)20-26(31)27(37-24-12-8-5-9-13-24)30(28(32)33)19-22-10-6-4-7-11-22/h4-17,21,26-27,31H,18-20H2,1-3H3,(H,32,33)/p-1 |
| InChIKey | RTJVWHZXKUNLQS-UHFFFAOYSA-M |
| XLogP | 3.67 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.71 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|