C28H35N3O5S2 — CID 10578740
3-amino-N-[(1S,2R)-2-hydroxy-3-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]-1-phenylsulfanylpropyl]-2-methylbenzamide (PubChem CID 10578740) has the molecular formula C28H35N3O5S2 and a molecular weight of 557.74 g/mol. Its IUPAC name is 3-amino-N-[(1S,2R)-2-hydroxy-3-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]-1-phenylsulfanylpropyl]-2-methylbenzamide.
| Compound Name | 3-amino-N-[(1S,2R)-2-hydroxy-3-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]-1-phenylsulfanylpropyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 10578740 |
| Molecular Formula | C28H35N3O5S2 |
| Molecular Weight | 557.74 g/mol |
| Exact Mass | 557.20 |
| IUPAC Name | 3-amino-N-[(1S,2R)-2-hydroxy-3-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]-1-phenylsulfanylpropyl]-2-methylbenzamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@@H](NC(=O)c2cccc(N)c2C)Sc2ccccc2)cc1 |
| InChI | InChI=1S/C28H35N3O5S2/c1-19(2)17-31(38(34,35)23-15-13-21(36-4)14-16-23)18-26(32)28(37-22-9-6-5-7-10-22)30-27(33)24-11-8-12-25(29)20(24)3/h5-16,19,26,28,32H,17-18,29H2,1-4H3,(H,30,33)/t26-,28+/m1/s1 |
| InChIKey | JOLXFELLRLRPSY-IAPPQJPRSA-N |
| XLogP | 4.14 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.74 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|