C18H20O3 — CID 57366932
(8R,9S,13S,14S)-3,17-dihydroxy-13-methyl-9,11,12,14,15,17-hexahydro-8H-cyclopenta[a]phenanthren-16-one (PubChem CID 57366932) has the molecular formula C18H20O3 and a molecular weight of 284.35 g/mol. Its IUPAC name is (8R,9S,13S,14S)-3,17-dihydroxy-13-methyl-9,11,12,14,15,17-hexahydro-8H-cyclopenta[a]phenanthren-16-one.
| Compound Name | (8R,9S,13S,14S)-3,17-dihydroxy-13-methyl-9,11,12,14,15,17-hexahydro-8H-cyclopenta[a]phenanthren-16-one |
|---|---|
| PubChem CID | 57366932 |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | (8R,9S,13S,14S)-3,17-dihydroxy-13-methyl-9,11,12,14,15,17-hexahydro-8H-cyclopenta[a]phenanthren-16-one |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)cc4C=C[C@H]3[C@@H]1CC(=O)C2O |
| InChI | InChI=1S/C18H20O3/c1-18-7-6-13-12-5-3-11(19)8-10(12)2-4-14(13)15(18)9-16(20)17(18)21/h2-5,8,13-15,17,19,21H,6-7,9H2,1H3/t13-,14-,15+,17?,18+/m1/s1 |
| InChIKey | GFHGDTNIZVWTKU-AUVIEDASSA-N |
| XLogP | 2.87 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |