C18H18N2O5S2 — CID 57368014
6-[5-[3-(4-nitrophenyl)prop-2-enylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid (PubChem CID 57368014) has the molecular formula C18H18N2O5S2 and a molecular weight of 406.49 g/mol. Its IUPAC name is 6-[5-[3-(4-nitrophenyl)prop-2-enylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid.
| Compound Name | 6-[5-[3-(4-nitrophenyl)prop-2-enylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 57368014 |
| Molecular Formula | C18H18N2O5S2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | 6-[5-[3-(4-nitrophenyl)prop-2-enylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid |
| SMILES | O=C(O)CCCCCN1C(=O)C(=CC=Cc2ccc([N+](=O)[O-])cc2)SC1=S |
| InChI | InChI=1S/C18H18N2O5S2/c21-16(22)7-2-1-3-12-19-17(23)15(27-18(19)26)6-4-5-13-8-10-14(11-9-13)20(24)25/h4-6,8-11H,1-3,7,12H2,(H,21,22) |
| InChIKey | SLBYDASGFWZCFY-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|