C22H19N3O5S2 — CID 6531587
N-(2-hydroxy-5-nitrophenyl)-4-[(5Z)-4-oxo-5-[(E)-3-phenylprop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide (PubChem CID 6531587) has the molecular formula C22H19N3O5S2 and a molecular weight of 469.54 g/mol. Its IUPAC name is N-(2-hydroxy-5-nitrophenyl)-4-[(5Z)-4-oxo-5-[(E)-3-phenylprop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide.
| Compound Name | N-(2-hydroxy-5-nitrophenyl)-4-[(5Z)-4-oxo-5-[(E)-3-phenylprop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide |
|---|---|
| PubChem CID | 6531587 |
| Molecular Formula | C22H19N3O5S2 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.08 |
| IUPAC Name | N-(2-hydroxy-5-nitrophenyl)-4-[(5Z)-4-oxo-5-[(E)-3-phenylprop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide |
| SMILES | O=C(CCCN1C(=O)/C(=C/C=C/c2ccccc2)SC1=S)Nc1cc([N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C22H19N3O5S2/c26-18-12-11-16(25(29)30)14-17(18)23-20(27)10-5-13-24-21(28)19(32-22(24)31)9-4-8-15-6-2-1-3-7-15/h1-4,6-9,11-12,14,26H,5,10,13H2,(H,23,27)/b8-4+,19-9- |
| InChIKey | RQFVJMXRAYAJNA-DURWOYGOSA-N |
| XLogP | 4.48 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|