C12H12BrF3N2O3S — CID 57368052
2-[[3-bromo-6-morpholin-4-yl-4-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetic acid (PubChem CID 57368052) has the molecular formula C12H12BrF3N2O3S and a molecular weight of 401.20 g/mol. Its IUPAC name is 2-[[3-bromo-6-morpholin-4-yl-4-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetic acid.
| Compound Name | 2-[[3-bromo-6-morpholin-4-yl-4-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 57368052 |
| Molecular Formula | C12H12BrF3N2O3S |
| Molecular Weight | 401.20 g/mol |
| Exact Mass | 399.97 |
| IUPAC Name | 2-[[3-bromo-6-morpholin-4-yl-4-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetic acid |
| SMILES | O=C(O)CSc1nc(N2CCOCC2)cc(C(F)(F)F)c1Br |
| InChI | InChI=1S/C12H12BrF3N2O3S/c13-10-7(12(14,15)16)5-8(18-1-3-21-4-2-18)17-11(10)22-6-9(19)20/h5H,1-4,6H2,(H,19,20) |
| InChIKey | OVLQLHGGDCTNHA-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.20 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |