C13H15F3N2O3S — CID 91654805
methyl 2-[[6-morpholin-4-yl-4-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetate (PubChem CID 91654805) has the molecular formula C13H15F3N2O3S and a molecular weight of 336.34 g/mol. Its IUPAC name is methyl 2-[[6-morpholin-4-yl-4-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetate.
| Compound Name | methyl 2-[[6-morpholin-4-yl-4-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetate |
|---|---|
| PubChem CID | 91654805 |
| Molecular Formula | C13H15F3N2O3S |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | methyl 2-[[6-morpholin-4-yl-4-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetate |
| SMILES | COC(=O)CSc1cc(C(F)(F)F)cc(N2CCOCC2)n1 |
| InChI | InChI=1S/C13H15F3N2O3S/c1-20-12(19)8-22-11-7-9(13(14,15)16)6-10(17-11)18-2-4-21-5-3-18/h6-7H,2-5,8H2,1H3 |
| InChIKey | KAEJLVVHAOEBEO-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |