C16H22N4O4S — CID 96535594
methyl 2-[6-[4-[(2R)-oxolane-2-carbonyl]piperazin-1-yl]pyrazin-2-yl]sulfanylacetate (PubChem CID 96535594) has the molecular formula C16H22N4O4S and a molecular weight of 366.44 g/mol. Its IUPAC name is methyl 2-[6-[4-[(2R)-oxolane-2-carbonyl]piperazin-1-yl]pyrazin-2-yl]sulfanylacetate.
| Compound Name | methyl 2-[6-[4-[(2R)-oxolane-2-carbonyl]piperazin-1-yl]pyrazin-2-yl]sulfanylacetate |
|---|---|
| PubChem CID | 96535594 |
| Molecular Formula | C16H22N4O4S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | methyl 2-[6-[4-[(2R)-oxolane-2-carbonyl]piperazin-1-yl]pyrazin-2-yl]sulfanylacetate |
| SMILES | COC(=O)CSc1cncc(N2CCN(C(=O)[C@H]3CCCO3)CC2)n1 |
| InChI | InChI=1S/C16H22N4O4S/c1-23-15(21)11-25-14-10-17-9-13(18-14)19-4-6-20(7-5-19)16(22)12-3-2-8-24-12/h9-10,12H,2-8,11H2,1H3/t12-/m1/s1 |
| InChIKey | WNEMINGHGUQUIR-GFCCVEGCSA-N |
| XLogP | 0.57 |
| TPSA | 84.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |