C16H21N5O2S — CID 133469518
methyl 2-[6-[4-(1-methylpyrazol-4-yl)piperidin-1-yl]pyrazin-2-yl]sulfanylacetate (PubChem CID 133469518) has the molecular formula C16H21N5O2S and a molecular weight of 347.44 g/mol. Its IUPAC name is methyl 2-[6-[4-(1-methylpyrazol-4-yl)piperidin-1-yl]pyrazin-2-yl]sulfanylacetate.
| Compound Name | methyl 2-[6-[4-(1-methylpyrazol-4-yl)piperidin-1-yl]pyrazin-2-yl]sulfanylacetate |
|---|---|
| PubChem CID | 133469518 |
| Molecular Formula | C16H21N5O2S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | methyl 2-[6-[4-(1-methylpyrazol-4-yl)piperidin-1-yl]pyrazin-2-yl]sulfanylacetate |
| SMILES | COC(=O)CSc1cncc(N2CCC(c3cnn(C)c3)CC2)n1 |
| InChI | InChI=1S/C16H21N5O2S/c1-20-10-13(7-18-20)12-3-5-21(6-4-12)14-8-17-9-15(19-14)24-11-16(22)23-2/h7-10,12H,3-6,11H2,1-2H3 |
| InChIKey | CATNARAYZGHSGZ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |