C11H10F3NO3 — CID 57368777
4,4,4-trifluoro-3-hydroxyimino-1-(2-hydroxy-5-methylphenyl)butan-1-one (PubChem CID 57368777) has the molecular formula C11H10F3NO3 and a molecular weight of 261.20 g/mol. Its IUPAC name is 4,4,4-trifluoro-3-hydroxyimino-1-(2-hydroxy-5-methylphenyl)butan-1-one.
| Compound Name | 4,4,4-trifluoro-3-hydroxyimino-1-(2-hydroxy-5-methylphenyl)butan-1-one |
|---|---|
| PubChem CID | 57368777 |
| Molecular Formula | C11H10F3NO3 |
| Molecular Weight | 261.20 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 4,4,4-trifluoro-3-hydroxyimino-1-(2-hydroxy-5-methylphenyl)butan-1-one |
| SMILES | Cc1ccc(O)c(C(=O)CC(=NO)C(F)(F)F)c1 |
| InChI | InChI=1S/C11H10F3NO3/c1-6-2-3-8(16)7(4-6)9(17)5-10(15-18)11(12,13)14/h2-4,16,18H,5H2,1H3 |
| InChIKey | JIQSIHNMNAIENF-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.20 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|