C16H13NO5 — CID 10566042
1-(2-hydroxy-5-methylphenyl)-3-(4-nitrophenyl)propane-1,3-dione (PubChem CID 10566042) has the molecular formula C16H13NO5 and a molecular weight of 299.28 g/mol. Its IUPAC name is 1-(2-hydroxy-5-methylphenyl)-3-(4-nitrophenyl)propane-1,3-dione.
| Compound Name | 1-(2-hydroxy-5-methylphenyl)-3-(4-nitrophenyl)propane-1,3-dione |
|---|---|
| PubChem CID | 10566042 |
| Molecular Formula | C16H13NO5 |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 1-(2-hydroxy-5-methylphenyl)-3-(4-nitrophenyl)propane-1,3-dione |
| SMILES | Cc1ccc(O)c(C(=O)CC(=O)c2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C16H13NO5/c1-10-2-7-14(18)13(8-10)16(20)9-15(19)11-3-5-12(6-4-11)17(21)22/h2-8,18H,9H2,1H3 |
| InChIKey | OKTZVCQDPIFHMO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 97.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.28 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|