C15H10N2O7 — CID 10449289
1-(2-hydroxy-3-nitrophenyl)-3-(4-nitrophenyl)propane-1,3-dione (PubChem CID 10449289) has the molecular formula C15H10N2O7 and a molecular weight of 330.25 g/mol. Its IUPAC name is 1-(2-hydroxy-3-nitrophenyl)-3-(4-nitrophenyl)propane-1,3-dione.
| Compound Name | 1-(2-hydroxy-3-nitrophenyl)-3-(4-nitrophenyl)propane-1,3-dione |
|---|---|
| PubChem CID | 10449289 |
| Molecular Formula | C15H10N2O7 |
| Molecular Weight | 330.25 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 1-(2-hydroxy-3-nitrophenyl)-3-(4-nitrophenyl)propane-1,3-dione |
| SMILES | O=C(CC(=O)c1cccc([N+](=O)[O-])c1O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H10N2O7/c18-13(9-4-6-10(7-5-9)16(21)22)8-14(19)11-2-1-3-12(15(11)20)17(23)24/h1-7,20H,8H2 |
| InChIKey | WHKWPPDHSQAKKU-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 140.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.25 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|