C27H22N2O6 — CID 10600433
1-[3-acetyl-5-hydroxy-2-methyl-1-(4-methylphenyl)indol-6-yl]-3-(4-nitrophenyl)propane-1,3-dione (PubChem CID 10600433) has the molecular formula C27H22N2O6 and a molecular weight of 470.48 g/mol. Its IUPAC name is 1-[3-acetyl-5-hydroxy-2-methyl-1-(4-methylphenyl)indol-6-yl]-3-(4-nitrophenyl)propane-1,3-dione.
| Compound Name | 1-[3-acetyl-5-hydroxy-2-methyl-1-(4-methylphenyl)indol-6-yl]-3-(4-nitrophenyl)propane-1,3-dione |
|---|---|
| PubChem CID | 10600433 |
| Molecular Formula | C27H22N2O6 |
| Molecular Weight | 470.48 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | 1-[3-acetyl-5-hydroxy-2-methyl-1-(4-methylphenyl)indol-6-yl]-3-(4-nitrophenyl)propane-1,3-dione |
| SMILES | CC(=O)c1c(C)n(-c2ccc(C)cc2)c2cc(C(=O)CC(=O)c3ccc([N+](=O)[O-])cc3)c(O)cc12 |
| InChI | InChI=1S/C27H22N2O6/c1-15-4-8-19(9-5-15)28-16(2)27(17(3)30)21-13-25(32)22(12-23(21)28)26(33)14-24(31)18-6-10-20(11-7-18)29(34)35/h4-13,32H,14H2,1-3H3 |
| InChIKey | ZLWHPHSNNMSVSA-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 119.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.48 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|