C16H30O2Si — CID 57372696
5-(3-dimethylsilyloxy-4,4-dimethylpent-1-en-2-yl)-2-methylcyclohexan-1-one (PubChem CID 57372696) has the molecular formula C16H30O2Si and a molecular weight of 282.50 g/mol. Its IUPAC name is 5-(3-dimethylsilyloxy-4,4-dimethylpent-1-en-2-yl)-2-methylcyclohexan-1-one.
| Compound Name | 5-(3-dimethylsilyloxy-4,4-dimethylpent-1-en-2-yl)-2-methylcyclohexan-1-one |
|---|---|
| PubChem CID | 57372696 |
| Molecular Formula | C16H30O2Si |
| Molecular Weight | 282.50 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | 5-(3-dimethylsilyloxy-4,4-dimethylpent-1-en-2-yl)-2-methylcyclohexan-1-one |
| SMILES | C=C(C1CCC(C)C(=O)C1)C(O[SiH](C)C)C(C)(C)C |
| InChI | InChI=1S/C16H30O2Si/c1-11-8-9-13(10-14(11)17)12(2)15(16(3,4)5)18-19(6)7/h11,13,15,19H,2,8-10H2,1,3-7H3 |
| InChIKey | MERCFUHBXCGHCU-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.50 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|