C20H36O3Si — CID 164676287
2-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]pent-4-enyl]-2,5-dimethylcyclohexane-1,3-dione (PubChem CID 164676287) has the molecular formula C20H36O3Si and a molecular weight of 352.59 g/mol. Its IUPAC name is 2-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]pent-4-enyl]-2,5-dimethylcyclohexane-1,3-dione.
| Compound Name | 2-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]pent-4-enyl]-2,5-dimethylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 164676287 |
| Molecular Formula | C20H36O3Si |
| Molecular Weight | 352.59 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | 2-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]pent-4-enyl]-2,5-dimethylcyclohexane-1,3-dione |
| SMILES | C=C(CCCC1(C)C(=O)CC(C)CC1=O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H36O3Si/c1-15(14-23-24(7,8)19(3,4)5)10-9-11-20(6)17(21)12-16(2)13-18(20)22/h16H,1,9-14H2,2-8H3 |
| InChIKey | ZPVYNZUIFFPFSM-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.59 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|