C24H42O3Si — CID 57412965
2-[2-[(1R,3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-1-methyl-2-methylidene-3-propan-2-ylcyclopentyl]ethyl]cyclohexane-1,3-dione (PubChem CID 57412965) has the molecular formula C24H42O3Si and a molecular weight of 406.68 g/mol. Its IUPAC name is 2-[2-[(1R,3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-1-methyl-2-methylidene-3-propan-2-ylcyclopentyl]ethyl]cyclohexane-1,3-dione.
| Compound Name | 2-[2-[(1R,3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-1-methyl-2-methylidene-3-propan-2-ylcyclopentyl]ethyl]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 57412965 |
| Molecular Formula | C24H42O3Si |
| Molecular Weight | 406.68 g/mol |
| Exact Mass | 406.29 |
| IUPAC Name | 2-[2-[(1R,3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-1-methyl-2-methylidene-3-propan-2-ylcyclopentyl]ethyl]cyclohexane-1,3-dione |
| SMILES | C=C1[C@@H](C(C)C)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@]1(C)CCC1C(=O)CCCC1=O |
| InChI | InChI=1S/C24H42O3Si/c1-16(2)19-15-22(27-28(8,9)23(4,5)6)24(7,17(19)3)14-13-18-20(25)11-10-12-21(18)26/h16,18-19,22H,3,10-15H2,1-2,4-9H3/t19-,22-,24-/m1/s1 |
| InChIKey | WWACXGCPPMXWFD-ZFJSRUIDSA-N |
| XLogP | 6.33 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.68 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|