C24H44O2Si — CID 57128965
(1R,3aR,7aR)-1-[(4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-methylhept-6-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one (PubChem CID 57128965) has the molecular formula C24H44O2Si and a molecular weight of 392.70 g/mol. Its IUPAC name is (1R,3aR,7aR)-1-[(4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-methylhept-6-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one.
| Compound Name | (1R,3aR,7aR)-1-[(4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-methylhept-6-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
|---|---|
| PubChem CID | 57128965 |
| Molecular Formula | C24H44O2Si |
| Molecular Weight | 392.70 g/mol |
| Exact Mass | 392.31 |
| IUPAC Name | (1R,3aR,7aR)-1-[(4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-methylhept-6-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
| SMILES | C=C(C)C[C@@H](CC(C)[C@H]1CC[C@H]2C(=O)CCC[C@]12C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H44O2Si/c1-17(2)15-19(26-27(8,9)23(4,5)6)16-18(3)20-12-13-21-22(25)11-10-14-24(20,21)7/h18-21H,1,10-16H2,2-9H3/t18?,19-,20+,21-,24+/m0/s1 |
| InChIKey | OAMHGBNHAUNZHS-YYDMRERESA-N |
| XLogP | 7.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.70 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|