C22H42O3Si — CID 10339890
4-[(1R,2E,3S)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-(methoxymethylidene)cyclohexyl]-3,3-dimethylbutan-2-one (PubChem CID 10339890) has the molecular formula C22H42O3Si and a molecular weight of 382.66 g/mol. Its IUPAC name is 4-[(1R,2E,3S)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-(methoxymethylidene)cyclohexyl]-3,3-dimethylbutan-2-one.
| Compound Name | 4-[(1R,2E,3S)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-(methoxymethylidene)cyclohexyl]-3,3-dimethylbutan-2-one |
|---|---|
| PubChem CID | 10339890 |
| Molecular Formula | C22H42O3Si |
| Molecular Weight | 382.66 g/mol |
| Exact Mass | 382.29 |
| IUPAC Name | 4-[(1R,2E,3S)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-(methoxymethylidene)cyclohexyl]-3,3-dimethylbutan-2-one |
| SMILES | CO/C=C1/[C@H](CCO[Si](C)(C)C(C)(C)C)CCC[C@@H]1CC(C)(C)C(C)=O |
| InChI | InChI=1S/C22H42O3Si/c1-17(23)22(5,6)15-19-12-10-11-18(20(19)16-24-7)13-14-25-26(8,9)21(2,3)4/h16,18-19H,10-15H2,1-9H3/b20-16-/t18-,19+/m0/s1 |
| InChIKey | KIKAZCYCLBANJM-QLKIMFNUSA-N |
| XLogP | 6.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.66 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|