C25H46O4Si — CID 71466739
4-[(7R,8S)-3-methoxy-4,7-dimethyl-3-tri(propan-2-yl)silyloxy-4,4a,5,6,7,8-hexahydroisochromen-8-yl]butan-2-one (PubChem CID 71466739) has the molecular formula C25H46O4Si and a molecular weight of 438.73 g/mol. Its IUPAC name is 4-[(7R,8S)-3-methoxy-4,7-dimethyl-3-tri(propan-2-yl)silyloxy-4,4a,5,6,7,8-hexahydroisochromen-8-yl]butan-2-one.
| Compound Name | 4-[(7R,8S)-3-methoxy-4,7-dimethyl-3-tri(propan-2-yl)silyloxy-4,4a,5,6,7,8-hexahydroisochromen-8-yl]butan-2-one |
|---|---|
| PubChem CID | 71466739 |
| Molecular Formula | C25H46O4Si |
| Molecular Weight | 438.73 g/mol |
| Exact Mass | 438.32 |
| IUPAC Name | 4-[(7R,8S)-3-methoxy-4,7-dimethyl-3-tri(propan-2-yl)silyloxy-4,4a,5,6,7,8-hexahydroisochromen-8-yl]butan-2-one |
| SMILES | COC1(O[Si](C(C)C)(C(C)C)C(C)C)OC=C2C(CC[C@@H](C)[C@@H]2CCC(C)=O)C1C |
| InChI | InChI=1S/C25H46O4Si/c1-16(2)30(17(3)4,18(5)6)29-25(27-10)21(9)23-13-11-19(7)22(14-12-20(8)26)24(23)15-28-25/h15-19,21-23H,11-14H2,1-10H3/t19-,21?,22+,23?,25?/m1/s1 |
| InChIKey | IUWZCKFPROWCCV-JDXNDGCKSA-N |
| XLogP | 7.06 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.73 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|