C24H48O3SiSn — CID 10530273
3-[[(1R,2E,3S)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-(methoxymethylidene)cyclohexyl]methyl]-4-trimethylstannylbutan-2-one (PubChem CID 10530273) has the molecular formula C24H48O3SiSn and a molecular weight of 531.44 g/mol. Its IUPAC name is 3-[[(1R,2E,3S)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-(methoxymethylidene)cyclohexyl]methyl]-4-trimethylstannylbutan-2-one.
| Compound Name | 3-[[(1R,2E,3S)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-(methoxymethylidene)cyclohexyl]methyl]-4-trimethylstannylbutan-2-one |
|---|---|
| PubChem CID | 10530273 |
| Molecular Formula | C24H48O3SiSn |
| Molecular Weight | 531.44 g/mol |
| Exact Mass | 532.24 |
| IUPAC Name | 3-[[(1R,2E,3S)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-(methoxymethylidene)cyclohexyl]methyl]-4-trimethylstannylbutan-2-one |
| SMILES | CO/C=C1/[C@H](CCO[Si](C)(C)C(C)(C)C)CCC[C@@H]1CC(C[Sn](C)(C)C)C(C)=O |
| InChI | InChI=1S/C21H39O3Si.3CH3.Sn/c1-16(17(2)22)14-19-11-9-10-18(20(19)15-23-6)12-13-24-25(7,8)21(3,4)5;;;;/h15-16,18-19H,1,9-14H2,2-8H3;3*1H3;/b20-15-;;;;/t16?,18-,19+;;;;/m0..../s1 |
| InChIKey | WYISEXJDTNGOOP-BNIZOZILSA-N |
| XLogP | 7.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.44 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|