C24H46O2Si — CID 24787722
(2S,5R,6R)-6-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-5-methyl-2-[(2S)-5-methylhex-5-en-2-yl]cycloheptan-1-one (PubChem CID 24787722) has the molecular formula C24H46O2Si and a molecular weight of 394.72 g/mol. Its IUPAC name is (2S,5R,6R)-6-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-5-methyl-2-[(2S)-5-methylhex-5-en-2-yl]cycloheptan-1-one.
| Compound Name | (2S,5R,6R)-6-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-5-methyl-2-[(2S)-5-methylhex-5-en-2-yl]cycloheptan-1-one |
|---|---|
| PubChem CID | 24787722 |
| Molecular Formula | C24H46O2Si |
| Molecular Weight | 394.72 g/mol |
| Exact Mass | 394.33 |
| IUPAC Name | (2S,5R,6R)-6-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-5-methyl-2-[(2S)-5-methylhex-5-en-2-yl]cycloheptan-1-one |
| SMILES | C=C(C)CC[C@H](C)[C@@H]1CC[C@@H](C)[C@H](CCCO[Si](C)(C)C(C)(C)C)CC1=O |
| InChI | InChI=1S/C24H46O2Si/c1-18(2)12-13-20(4)22-15-14-19(3)21(17-23(22)25)11-10-16-26-27(8,9)24(5,6)7/h19-22H,1,10-17H2,2-9H3/t19-,20+,21-,22+/m1/s1 |
| InChIKey | XEDIGLLMZZXOSP-MBDNFAEBSA-N |
| XLogP | 7.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.72 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|