C21H31FO3 — CID 57373478
[(1S,2R,11S,12S,16S)-5-fluoro-2,16-dimethyl-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecan-15-yl] acetate (PubChem CID 57373478) has the molecular formula C21H31FO3 and a molecular weight of 350.47 g/mol. Its IUPAC name is [(1S,2R,11S,12S,16S)-5-fluoro-2,16-dimethyl-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecan-15-yl] acetate.
| Compound Name | [(1S,2R,11S,12S,16S)-5-fluoro-2,16-dimethyl-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecan-15-yl] acetate |
|---|---|
| PubChem CID | 57373478 |
| Molecular Formula | C21H31FO3 |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | [(1S,2R,11S,12S,16S)-5-fluoro-2,16-dimethyl-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecan-15-yl] acetate |
| SMILES | CC(=O)OC1CC[C@H]2[C@@H]3CC4OC45CC(F)CC[C@]5(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C21H31FO3/c1-12(23)24-17-5-4-15-14-10-18-21(25-18)11-13(22)6-9-20(21,3)16(14)7-8-19(15,17)2/h13-18H,4-11H2,1-3H3/t13?,14-,15-,16-,17?,18?,19-,20+,21?/m0/s1 |
| InChIKey | QICCPWCWEQASDE-FBDPZRLXSA-N |
| XLogP | 4.43 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|