C33H64O3Si2 — CID 57373808
(8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-3,6-bis(trimethylsilyloxy)-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-5-ol (PubChem CID 57373808) has the molecular formula C33H64O3Si2 and a molecular weight of 565.04 g/mol. Its IUPAC name is (8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-3,6-bis(trimethylsilyloxy)-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-5-ol.
| Compound Name | (8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-3,6-bis(trimethylsilyloxy)-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-5-ol |
|---|---|
| PubChem CID | 57373808 |
| Molecular Formula | C33H64O3Si2 |
| Molecular Weight | 565.04 g/mol |
| Exact Mass | 564.44 |
| IUPAC Name | (8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-3,6-bis(trimethylsilyloxy)-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-5-ol |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC(O[Si](C)(C)C)C4(O)CC(O[Si](C)(C)C)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C33H64O3Si2/c1-23(2)13-12-14-24(3)27-15-16-28-26-21-30(36-38(9,10)11)33(34)22-25(35-37(6,7)8)17-20-32(33,5)29(26)18-19-31(27,28)4/h23-30,34H,12-22H2,1-11H3/t24-,25?,26+,27-,28+,29+,30?,31-,32-,33?/m1/s1 |
| InChIKey | KWIQODZBGTZEPJ-HDMRSPNDSA-N |
| XLogP | 9.27 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.04 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|