C11H20F2N6O — CID 57378018
2-N-(2,2-difluoroethoxy)-4-N,6-N-dipropyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 57378018) has the molecular formula C11H20F2N6O and a molecular weight of 290.32 g/mol. Its IUPAC name is 2-N-(2,2-difluoroethoxy)-4-N,6-N-dipropyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-(2,2-difluoroethoxy)-4-N,6-N-dipropyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 57378018 |
| Molecular Formula | C11H20F2N6O |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 2-N-(2,2-difluoroethoxy)-4-N,6-N-dipropyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCCNc1nc(NCCC)nc(NOCC(F)F)n1 |
| InChI | InChI=1S/C11H20F2N6O/c1-3-5-14-9-16-10(15-6-4-2)18-11(17-9)19-20-7-8(12)13/h8H,3-7H2,1-2H3,(H3,14,15,16,17,18,19) |
| InChIKey | JXEGHKNWISAGCP-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 83.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|