C13H10ClF2NO3S2 — CID 57378877
N-(5-chloro-2-methylsulfinylphenyl)-2,4-difluorobenzenesulfonamide (PubChem CID 57378877) has the molecular formula C13H10ClF2NO3S2 and a molecular weight of 365.81 g/mol. Its IUPAC name is N-(5-chloro-2-methylsulfinylphenyl)-2,4-difluorobenzenesulfonamide.
| Compound Name | N-(5-chloro-2-methylsulfinylphenyl)-2,4-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 57378877 |
| Molecular Formula | C13H10ClF2NO3S2 |
| Molecular Weight | 365.81 g/mol |
| Exact Mass | 364.98 |
| IUPAC Name | N-(5-chloro-2-methylsulfinylphenyl)-2,4-difluorobenzenesulfonamide |
| SMILES | CS(=O)c1ccc(Cl)cc1NS(=O)(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C13H10ClF2NO3S2/c1-21(18)12-4-2-8(14)6-11(12)17-22(19,20)13-5-3-9(15)7-10(13)16/h2-7,17H,1H3 |
| InChIKey | VSYVRTYGAHJLQP-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.81 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |