C22H48O3Si2 — CID 57379990
(3S,4R)-6-[tert-butyl(dimethyl)silyl]oxy-3-methyl-4-tri(propan-2-yl)silyloxyhexanal (PubChem CID 57379990) has the molecular formula C22H48O3Si2 and a molecular weight of 416.80 g/mol. Its IUPAC name is (3S,4R)-6-[tert-butyl(dimethyl)silyl]oxy-3-methyl-4-tri(propan-2-yl)silyloxyhexanal.
| Compound Name | (3S,4R)-6-[tert-butyl(dimethyl)silyl]oxy-3-methyl-4-tri(propan-2-yl)silyloxyhexanal |
|---|---|
| PubChem CID | 57379990 |
| Molecular Formula | C22H48O3Si2 |
| Molecular Weight | 416.80 g/mol |
| Exact Mass | 416.31 |
| IUPAC Name | (3S,4R)-6-[tert-butyl(dimethyl)silyl]oxy-3-methyl-4-tri(propan-2-yl)silyloxyhexanal |
| SMILES | CC(C)[Si](O[C@H](CCO[Si](C)(C)C(C)(C)C)[C@@H](C)CC=O)(C(C)C)C(C)C |
| InChI | InChI=1S/C22H48O3Si2/c1-17(2)27(18(3)4,19(5)6)25-21(20(7)13-15-23)14-16-24-26(11,12)22(8,9)10/h15,17-21H,13-14,16H2,1-12H3/t20-,21+/m0/s1 |
| InChIKey | ZLFUVOGLRRIPRM-LEWJYISDSA-N |
| XLogP | 7.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.80 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|