C28H26O5S — CID 57380443
1-[(R)-[3,4-dimethoxy-2-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]sulfinyl]-2-methoxynaphthalene (PubChem CID 57380443) has the molecular formula C28H26O5S and a molecular weight of 474.58 g/mol. Its IUPAC name is 1-[(R)-[3,4-dimethoxy-2-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]sulfinyl]-2-methoxynaphthalene.
| Compound Name | 1-[(R)-[3,4-dimethoxy-2-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]sulfinyl]-2-methoxynaphthalene |
|---|---|
| PubChem CID | 57380443 |
| Molecular Formula | C28H26O5S |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | 1-[(R)-[3,4-dimethoxy-2-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]sulfinyl]-2-methoxynaphthalene |
| SMILES | COc1ccc(/C=C/c2c([S@@](=O)c3c(OC)ccc4ccccc34)ccc(OC)c2OC)cc1 |
| InChI | InChI=1S/C28H26O5S/c1-30-21-13-9-19(10-14-21)11-15-23-26(18-17-24(31-2)27(23)33-4)34(29)28-22-8-6-5-7-20(22)12-16-25(28)32-3/h5-18H,1-4H3/b15-11+/t34-/m1/s1 |
| InChIKey | XMXRRMNNFWUVAI-KVGQWCTNSA-N |
| XLogP | 6.21 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|