C13H12Cl2N4O2 — CID 57381421
2-[2-(2,6-dichlorophenyl)ethylamino]-N-hydroxypyrimidine-5-carboxamide (PubChem CID 57381421) has the molecular formula C13H12Cl2N4O2 and a molecular weight of 327.17 g/mol. Its IUPAC name is 2-[2-(2,6-dichlorophenyl)ethylamino]-N-hydroxypyrimidine-5-carboxamide.
| Compound Name | 2-[2-(2,6-dichlorophenyl)ethylamino]-N-hydroxypyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 57381421 |
| Molecular Formula | C13H12Cl2N4O2 |
| Molecular Weight | 327.17 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | 2-[2-(2,6-dichlorophenyl)ethylamino]-N-hydroxypyrimidine-5-carboxamide |
| SMILES | O=C(NO)c1cnc(NCCc2c(Cl)cccc2Cl)nc1 |
| InChI | InChI=1S/C13H12Cl2N4O2/c14-10-2-1-3-11(15)9(10)4-5-16-13-17-6-8(7-18-13)12(20)19-21/h1-3,6-7,21H,4-5H2,(H,19,20)(H,16,17,18) |
| InChIKey | URNAJSRCJGAVQR-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.17 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|