C19H21F2NO2 — CID 57381743
(3S)-2,2-difluoro-3-hydroxy-3-phenyl-N-[(1S)-1-phenylethyl]pentanamide (PubChem CID 57381743) has the molecular formula C19H21F2NO2 and a molecular weight of 333.38 g/mol. Its IUPAC name is (3S)-2,2-difluoro-3-hydroxy-3-phenyl-N-[(1S)-1-phenylethyl]pentanamide.
| Compound Name | (3S)-2,2-difluoro-3-hydroxy-3-phenyl-N-[(1S)-1-phenylethyl]pentanamide |
|---|---|
| PubChem CID | 57381743 |
| Molecular Formula | C19H21F2NO2 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | (3S)-2,2-difluoro-3-hydroxy-3-phenyl-N-[(1S)-1-phenylethyl]pentanamide |
| SMILES | CC[C@](O)(c1ccccc1)C(F)(F)C(=O)N[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C19H21F2NO2/c1-3-18(24,16-12-8-5-9-13-16)19(20,21)17(23)22-14(2)15-10-6-4-7-11-15/h4-14,24H,3H2,1-2H3,(H,22,23)/t14-,18-/m0/s1 |
| InChIKey | SVNBSMUDKBZJKF-KSSFIOAISA-N |
| XLogP | 3.80 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |