C15H22FN3O6 — CID 57381858
[1-(3,4-dihydroxy-5-methyloxolan-2-yl)-5-fluoro-2-oxopyrimidin-4-yl]-pentylcarbamic acid (PubChem CID 57381858) has the molecular formula C15H22FN3O6 and a molecular weight of 359.35 g/mol. Its IUPAC name is [1-(3,4-dihydroxy-5-methyloxolan-2-yl)-5-fluoro-2-oxopyrimidin-4-yl]-pentylcarbamic acid.
| Compound Name | [1-(3,4-dihydroxy-5-methyloxolan-2-yl)-5-fluoro-2-oxopyrimidin-4-yl]-pentylcarbamic acid |
|---|---|
| PubChem CID | 57381858 |
| Molecular Formula | C15H22FN3O6 |
| Molecular Weight | 359.35 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | [1-(3,4-dihydroxy-5-methyloxolan-2-yl)-5-fluoro-2-oxopyrimidin-4-yl]-pentylcarbamic acid |
| SMILES | CCCCCN(C(=O)O)c1nc(=O)n(C2OC(C)C(O)C2O)cc1F |
| InChI | InChI=1S/C15H22FN3O6/c1-3-4-5-6-18(15(23)24)12-9(16)7-19(14(22)17-12)13-11(21)10(20)8(2)25-13/h7-8,10-11,13,20-21H,3-6H2,1-2H3,(H,23,24) |
| InChIKey | MTNRCWYJUSNYAI-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.35 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|