C21H21F2N2O2+ — CID 57383764
N-[(3,4-difluorophenyl)-(1-hydroxyquinolin-1-ium-7-yl)methyl]-3-methylbutanamide (PubChem CID 57383764) has the molecular formula C21H21F2N2O2+ and a molecular weight of 371.41 g/mol. Its IUPAC name is N-[(3,4-difluorophenyl)-(1-hydroxyquinolin-1-ium-7-yl)methyl]-3-methylbutanamide.
| Compound Name | N-[(3,4-difluorophenyl)-(1-hydroxyquinolin-1-ium-7-yl)methyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 57383764 |
| Molecular Formula | C21H21F2N2O2+ |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | N-[(3,4-difluorophenyl)-(1-hydroxyquinolin-1-ium-7-yl)methyl]-3-methylbutanamide |
| SMILES | CC(C)CC(=O)NC(c1ccc(F)c(F)c1)c1ccc2ccc[n+](O)c2c1 |
| InChI | InChI=1S/C21H20F2N2O2/c1-13(2)10-20(26)24-21(15-7-8-17(22)18(23)11-15)16-6-5-14-4-3-9-25(27)19(14)12-16/h3-9,11-13,21H,10H2,1-2H3,(H-,24,26,27)/p+1 |
| InChIKey | FNHKAEBNSDMIAA-UHFFFAOYSA-O |
| XLogP | 3.89 |
| TPSA | 53.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|