C25H27F2N3O2 — CID 57383832
N-[(3,4-difluorophenyl)-(8-hydroxy-2-pyrrolidin-1-ylquinolin-7-yl)methyl]-3-methylbutanamide (PubChem CID 57383832) has the molecular formula C25H27F2N3O2 and a molecular weight of 439.51 g/mol. Its IUPAC name is N-[(3,4-difluorophenyl)-(8-hydroxy-2-pyrrolidin-1-ylquinolin-7-yl)methyl]-3-methylbutanamide.
| Compound Name | N-[(3,4-difluorophenyl)-(8-hydroxy-2-pyrrolidin-1-ylquinolin-7-yl)methyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 57383832 |
| Molecular Formula | C25H27F2N3O2 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | N-[(3,4-difluorophenyl)-(8-hydroxy-2-pyrrolidin-1-ylquinolin-7-yl)methyl]-3-methylbutanamide |
| SMILES | CC(C)CC(=O)NC(c1ccc(F)c(F)c1)c1ccc2ccc(N3CCCC3)nc2c1O |
| InChI | InChI=1S/C25H27F2N3O2/c1-15(2)13-22(31)29-23(17-6-9-19(26)20(27)14-17)18-8-5-16-7-10-21(28-24(16)25(18)32)30-11-3-4-12-30/h5-10,14-15,23,32H,3-4,11-13H2,1-2H3,(H,29,31) |
| InChIKey | RYNVRKOWUGYBEL-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|