C20H16ClNO2S — CID 57384082
1-[3-chloro-4-[(4-phenyl-1,3-thiazol-2-yl)methoxy]phenyl]-2-methylprop-2-en-1-one (PubChem CID 57384082) has the molecular formula C20H16ClNO2S and a molecular weight of 369.87 g/mol. Its IUPAC name is 1-[3-chloro-4-[(4-phenyl-1,3-thiazol-2-yl)methoxy]phenyl]-2-methylprop-2-en-1-one.
| Compound Name | 1-[3-chloro-4-[(4-phenyl-1,3-thiazol-2-yl)methoxy]phenyl]-2-methylprop-2-en-1-one |
|---|---|
| PubChem CID | 57384082 |
| Molecular Formula | C20H16ClNO2S |
| Molecular Weight | 369.87 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | 1-[3-chloro-4-[(4-phenyl-1,3-thiazol-2-yl)methoxy]phenyl]-2-methylprop-2-en-1-one |
| SMILES | C=C(C)C(=O)c1ccc(OCc2nc(-c3ccccc3)cs2)c(Cl)c1 |
| InChI | InChI=1S/C20H16ClNO2S/c1-13(2)20(23)15-8-9-18(16(21)10-15)24-11-19-22-17(12-25-19)14-6-4-3-5-7-14/h3-10,12H,1,11H2,2H3 |
| InChIKey | XUBLQSWKLVAXSB-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.87 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|