About 7-benzyl-5,6-dimethyl-4-(2-piperazin-1-ylethoxy)pyrrolo[2,3-d]pyrimidine
7-benzyl-5,6-dimethyl-4-(2-piperazin-1-ylethoxy)pyrrolo[2,3-d]pyrimidine (PubChem CID 57389815) has the molecular formula C21H27N5O
and a molecular weight of 365.48 g/mol. Its IUPAC name is 7-benzyl-5,6-dimethyl-4-(2-piperazin-1-ylethoxy)pyrrolo[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | 7-benzyl-5,6-dimethyl-4-(2-piperazin-1-ylethoxy)pyrrolo[2,3-d]pyrimidine |
| PubChem CID | 57389815 |
| Molecular Formula | C21H27N5O |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | 7-benzyl-5,6-dimethyl-4-(2-piperazin-1-ylethoxy)pyrrolo[2,3-d]pyrimidine |
| SMILES | Cc1c(C)n(Cc2ccccc2)c2ncnc(OCCN3CCNCC3)c12 |
| InChI | InChI=1S/C21H27N5O/c1-16-17(2)26(14-18-6-4-3-5-7-18)20-19(16)21(24-15-23-20)27-13-12-25-10-8-22-9-11-25/h3-7,15,22H,8-14H2,1-2H3 |
| InChIKey | YPUWSORNGVLDMT-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-benzyl-5,6-dimethyl-4-(2-piperazin-1-ylethoxy)pyrrolo[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-benzyl-5,6-dimethyl-4-(2-piperazin-1-ylethoxy)pyrrolo[2,3-d]pyrimidine?
The IUPAC name of 7-benzyl-5,6-dimethyl-4-(2-piperazin-1-ylethoxy)pyrrolo[2,3-d]pyrimidine (CID 57389815) is 7-benzyl-5,6-dimethyl-4-(2-piperazin-1-ylethoxy)pyrrolo[2,3-d]pyrimidine.
What is the SMILES notation for 7-benzyl-5,6-dimethyl-4-(2-piperazin-1-ylethoxy)pyrrolo[2,3-d]pyrimidine?
The canonical SMILES for 7-benzyl-5,6-dimethyl-4-(2-piperazin-1-ylethoxy)pyrrolo[2,3-d]pyrimidine is Cc1c(C)n(Cc2ccccc2)c2ncnc(OCCN3CCNCC3)c12.
What is the InChIKey of 7-benzyl-5,6-dimethyl-4-(2-piperazin-1-ylethoxy)pyrrolo[2,3-d]pyrimidine?
The InChIKey is YPUWSORNGVLDMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27N5O/c1-16-17(2)26(14-18-6-4-3-5-7-18)20-19(16)21(24-15-23-20)27-13-12-25-10-8-22-9-11-25/h3-7,15,22H,8-14H2,1-2H3.
What are the key properties of 7-benzyl-5,6-dimethyl-4-(2-piperazin-1-ylethoxy)pyrrolo[2,3-d]pyrimidine?
7-benzyl-5,6-dimethyl-4-(2-piperazin-1-ylethoxy)pyrrolo[2,3-d]pyrimidine has a molecular weight of 365.48 g/mol, XLogP of 2.38, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-benzyl-5,6-dimethyl-4-(2-piperazin-1-ylethoxy)pyrrolo[2,3-d]pyrimidine is sourced from PubChem (CID 57389815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).