C29H38F2N4O4 — CID 57394700
(2S)-N-[(1R,2S)-3-(3,5-difluorophenyl)-1-hydroxy-1-[(2R,4R)-4-pyridin-2-yloxypyrrolidin-2-yl]propan-2-yl]-2-[(3S)-3-(2-methylpropyl)-2-oxopyrrolidin-1-yl]propanamide (PubChem CID 57394700) has the molecular formula C29H38F2N4O4 and a molecular weight of 544.64 g/mol. Its IUPAC name is (2S)-N-[(1R,2S)-3-(3,5-difluorophenyl)-1-hydroxy-1-[(2R,4R)-4-pyridin-2-yloxypyrrolidin-2-yl]propan-2-yl]-2-[(3S)-3-(2-methylpropyl)-2-oxopyrrolidin-1-yl]propanamide.
| Compound Name | (2S)-N-[(1R,2S)-3-(3,5-difluorophenyl)-1-hydroxy-1-[(2R,4R)-4-pyridin-2-yloxypyrrolidin-2-yl]propan-2-yl]-2-[(3S)-3-(2-methylpropyl)-2-oxopyrrolidin-1-yl]propanamide |
|---|---|
| PubChem CID | 57394700 |
| Molecular Formula | C29H38F2N4O4 |
| Molecular Weight | 544.64 g/mol |
| Exact Mass | 544.29 |
| IUPAC Name | (2S)-N-[(1R,2S)-3-(3,5-difluorophenyl)-1-hydroxy-1-[(2R,4R)-4-pyridin-2-yloxypyrrolidin-2-yl]propan-2-yl]-2-[(3S)-3-(2-methylpropyl)-2-oxopyrrolidin-1-yl]propanamide |
| SMILES | CC(C)C[C@H]1CCN([C@@H](C)C(=O)N[C@@H](Cc2cc(F)cc(F)c2)[C@H](O)[C@H]2C[C@@H](Oc3ccccn3)CN2)C1=O |
| InChI | InChI=1S/C29H38F2N4O4/c1-17(2)10-20-7-9-35(29(20)38)18(3)28(37)34-25(13-19-11-21(30)14-22(31)12-19)27(36)24-15-23(16-33-24)39-26-6-4-5-8-32-26/h4-6,8,11-12,14,17-18,20,23-25,27,33,36H,7,9-10,13,15-16H2,1-3H3,(H,34,37)/t18-,20+,23+,24+,25-,27+/m0/s1 |
| InChIKey | OMRUCWQDVCCDPB-OLPGIOPVSA-N |
| XLogP | 2.84 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.64 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |