C17H14F3NO4S — CID 57395821
2-[1,1-dioxo-2-[(2,4,5-trifluorophenyl)methyl]-3,4-dihydro-1λ6,2-benzothiazin-4-yl]acetic acid (PubChem CID 57395821) has the molecular formula C17H14F3NO4S and a molecular weight of 385.36 g/mol. Its IUPAC name is 2-[1,1-dioxo-2-[(2,4,5-trifluorophenyl)methyl]-3,4-dihydro-1λ6,2-benzothiazin-4-yl]acetic acid.
| Compound Name | 2-[1,1-dioxo-2-[(2,4,5-trifluorophenyl)methyl]-3,4-dihydro-1λ6,2-benzothiazin-4-yl]acetic acid |
|---|---|
| PubChem CID | 57395821 |
| Molecular Formula | C17H14F3NO4S |
| Molecular Weight | 385.36 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | 2-[1,1-dioxo-2-[(2,4,5-trifluorophenyl)methyl]-3,4-dihydro-1λ6,2-benzothiazin-4-yl]acetic acid |
| SMILES | O=C(O)CC1CN(Cc2cc(F)c(F)cc2F)S(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C17H14F3NO4S/c18-13-7-15(20)14(19)5-11(13)9-21-8-10(6-17(22)23)12-3-1-2-4-16(12)26(21,24)25/h1-5,7,10H,6,8-9H2,(H,22,23) |
| InChIKey | JIYOUJVUEXKGMY-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|